The current position:OPTICAL BRIGHTER AGENT
Fluorescent Brightener KCB
product Name |
Fluorescent Brightener KCB |
Synonyms |
C.I NO.367; FLUORESCENT BRIGHTENER-KCB;
1,4-bis(benziazolyl-2-yl-)naphth-alene; |
Molecular Formula |
C24H14N2O2 |
Molecular Weight |
362.3802 |
InChI |
InChI=1/C24H14N2O2/c1-2-8-16-15(7-1)17(23-25-19-9-3-5-11-21(19)27-23)13-14-18(16)24-26-20-10-4-6-12-22(20)28-24/h1-14H |
CAS Registry Number |
5089-22-5;63310-10-1 |
EINECS |
225-803-5 |
Molecular Structure |
 |
Density |
1.32g/cm3 |
Melting point |
210-212℃ |
Boiling point |
521.9°C at 760 mmHg |
Refractive index |
1.731 |
Flash point |
263.1°C |
Water solubility |
insoluble |
Vapour Pressur |
1.8E-10mmHg at 25°C |
Properties: |
Appearance: light yellow powder
Melting point :201-202 ℃
Purity: ≥ 99.00%
Volatile: ≤ 0.2%
Transmittance: 450nm ≥ 96% 500nm ≥ 97% |
Usage: |
This product can be used for whitening thermoplastic plastics, polyvinyl chloride, polystyrene, polyethylene, polypropylene, ABS, acetate fibers, paints, coatings, printing paint, the brightener OB used in various stages of processing polymer whitening can be processed to give a bright blue-white sheen. |